C16H24N2O — CID 135050661
(Z,2S)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2-methyl-3-phenylpropan-1-imine (PubChem CID 135050661) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is (Z,2S)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2-methyl-3-phenylpropan-1-imine.
| Compound Name | (Z,2S)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2-methyl-3-phenylpropan-1-imine |
|---|---|
| PubChem CID | 135050661 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | (Z,2S)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2-methyl-3-phenylpropan-1-imine |
| SMILES | COC[C@@H]1CCCN1/N=C\[C@@H](C)Cc1ccccc1 |
| InChI | InChI=1S/C16H24N2O/c1-14(11-15-7-4-3-5-8-15)12-17-18-10-6-9-16(18)13-19-2/h3-5,7-8,12,14,16H,6,9-11,13H2,1-2H3/b17-12-/t14-,16-/m0/s1 |
| InChIKey | HKHHNWNSPWVIRS-NPVOPIMNSA-N |
| XLogP | 2.96 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|