C21H36N2OSi — CID 15971722
(E,2R)-2-[tert-butyl(dimethyl)silyl]-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-3-phenylpropan-1-imine (PubChem CID 15971722) has the molecular formula C21H36N2OSi and a molecular weight of 360.62 g/mol. Its IUPAC name is (E,2R)-2-[tert-butyl(dimethyl)silyl]-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-3-phenylpropan-1-imine.
| Compound Name | (E,2R)-2-[tert-butyl(dimethyl)silyl]-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-3-phenylpropan-1-imine |
|---|---|
| PubChem CID | 15971722 |
| Molecular Formula | C21H36N2OSi |
| Molecular Weight | 360.62 g/mol |
| Exact Mass | 360.26 |
| IUPAC Name | (E,2R)-2-[tert-butyl(dimethyl)silyl]-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-3-phenylpropan-1-imine |
| SMILES | COC[C@@H]1CCCN1/N=C/[C@@H](Cc1ccccc1)[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H36N2OSi/c1-21(2,3)25(5,6)20(15-18-11-8-7-9-12-18)16-22-23-14-10-13-19(23)17-24-4/h7-9,11-12,16,19-20H,10,13-15,17H2,1-6H3/b22-16+/t19-,20+/m0/s1 |
| InChIKey | LCYTWZRMCGUZCF-JFTLIWJPSA-N |
| XLogP | 5.20 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.62 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|