C11H20N2O2 — CID 177492712
(1E)-1-[2-(methoxymethyl)pyrrolidin-1-yl]iminopent-4-en-2-ol (PubChem CID 177492712) has the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. Its IUPAC name is (1E)-1-[2-(methoxymethyl)pyrrolidin-1-yl]iminopent-4-en-2-ol.
| Compound Name | (1E)-1-[2-(methoxymethyl)pyrrolidin-1-yl]iminopent-4-en-2-ol |
|---|---|
| PubChem CID | 177492712 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | (1E)-1-[2-(methoxymethyl)pyrrolidin-1-yl]iminopent-4-en-2-ol |
| SMILES | C=CCC(O)/C=N/N1CCCC1COC |
| InChI | InChI=1S/C11H20N2O2/c1-3-5-11(14)8-12-13-7-4-6-10(13)9-15-2/h3,8,10-11,14H,1,4-7,9H2,2H3/b12-8+ |
| InChIKey | PIKWXPJKJLCTFB-XYOKQWHBSA-N |
| XLogP | 1.02 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|