C11H22N2O3 — CID 11128124
(E)-2-methoxy-N-[(2S)-2-(2-methoxyethoxymethyl)pyrrolidin-1-yl]ethanimine (PubChem CID 11128124) has the molecular formula C11H22N2O3 and a molecular weight of 230.31 g/mol. Its IUPAC name is (E)-2-methoxy-N-[(2S)-2-(2-methoxyethoxymethyl)pyrrolidin-1-yl]ethanimine.
| Compound Name | (E)-2-methoxy-N-[(2S)-2-(2-methoxyethoxymethyl)pyrrolidin-1-yl]ethanimine |
|---|---|
| PubChem CID | 11128124 |
| Molecular Formula | C11H22N2O3 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.16 |
| IUPAC Name | (E)-2-methoxy-N-[(2S)-2-(2-methoxyethoxymethyl)pyrrolidin-1-yl]ethanimine |
| SMILES | COC/C=N/N1CCC[C@H]1COCCOC |
| InChI | InChI=1S/C11H22N2O3/c1-14-7-5-12-13-6-3-4-11(13)10-16-9-8-15-2/h5,11H,3-4,6-10H2,1-2H3/b12-5+/t11-/m0/s1 |
| InChIKey | YMWUSCSOAVMSBA-FIJZOYEMSA-N |
| XLogP | 0.75 |
| TPSA | 43.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|