C15H27BN2O3 — CID 177407968
(E,E)-N-[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-imine (PubChem CID 177407968) has the molecular formula C15H27BN2O3 and a molecular weight of 294.20 g/mol. Its IUPAC name is (E,E)-N-[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-imine.
| Compound Name | (E,E)-N-[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-imine |
|---|---|
| PubChem CID | 177407968 |
| Molecular Formula | C15H27BN2O3 |
| Molecular Weight | 294.20 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | (E,E)-N-[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-imine |
| SMILES | COC[C@H]1CCCN1/N=C/C=C/B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C15H27BN2O3/c1-14(2)15(3,4)21-16(20-14)9-7-10-17-18-11-6-8-13(18)12-19-5/h7,9-10,13H,6,8,11-12H2,1-5H3/b9-7+,17-10+/t13-/m1/s1 |
| InChIKey | YEEZWQPWZYTDKB-ZBGLROHASA-N |
| XLogP | 2.27 |
| TPSA | 43.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.20 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|