C16H28N2O — CID 177391876
(E,6E,8E)-N-[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]deca-6,8-dien-1-imine (PubChem CID 177391876) has the molecular formula C16H28N2O and a molecular weight of 264.41 g/mol. Its IUPAC name is (E,6E,8E)-N-[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]deca-6,8-dien-1-imine.
| Compound Name | (E,6E,8E)-N-[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]deca-6,8-dien-1-imine |
|---|---|
| PubChem CID | 177391876 |
| Molecular Formula | C16H28N2O |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.22 |
| IUPAC Name | (E,6E,8E)-N-[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]deca-6,8-dien-1-imine |
| SMILES | C/C=C/C=C/CCCC/C=N/N1CCC[C@@H]1COC |
| InChI | InChI=1S/C16H28N2O/c1-3-4-5-6-7-8-9-10-13-17-18-14-11-12-16(18)15-19-2/h3-6,13,16H,7-12,14-15H2,1-2H3/b4-3+,6-5+,17-13+/t16-/m1/s1 |
| InChIKey | DONVRIMXYJBBCW-QNYJWHIJSA-N |
| XLogP | 3.78 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|