C22H39F3N2OS — CID 102079963
(E,3S)-3-[(Z)-dodec-9-enyl]sulfanyl-1,1,1-trifluoro-N-[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]butan-2-imine (PubChem CID 102079963) has the molecular formula C22H39F3N2OS and a molecular weight of 436.63 g/mol. Its IUPAC name is (E,3S)-3-[(Z)-dodec-9-enyl]sulfanyl-1,1,1-trifluoro-N-[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]butan-2-imine.
| Compound Name | (E,3S)-3-[(Z)-dodec-9-enyl]sulfanyl-1,1,1-trifluoro-N-[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]butan-2-imine |
|---|---|
| PubChem CID | 102079963 |
| Molecular Formula | C22H39F3N2OS |
| Molecular Weight | 436.63 g/mol |
| Exact Mass | 436.27 |
| IUPAC Name | (E,3S)-3-[(Z)-dodec-9-enyl]sulfanyl-1,1,1-trifluoro-N-[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]butan-2-imine |
| SMILES | CC/C=C\CCCCCCCCS[C@@H](C)/C(=N/N1CCC[C@@H]1COC)C(F)(F)F |
| InChI | InChI=1S/C22H39F3N2OS/c1-4-5-6-7-8-9-10-11-12-13-17-29-19(2)21(22(23,24)25)26-27-16-14-15-20(27)18-28-3/h5-6,19-20H,4,7-18H2,1-3H3/b6-5-,26-21-/t19-,20+/m0/s1 |
| InChIKey | JLZAFRYUZSJZNV-ZKIIEJFNSA-N |
| XLogP | 6.83 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.63 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|