C17H34N2O — CID 134876840
(E,4R)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-4-methyldecan-3-imine (PubChem CID 134876840) has the molecular formula C17H34N2O and a molecular weight of 282.47 g/mol. Its IUPAC name is (E,4R)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-4-methyldecan-3-imine.
| Compound Name | (E,4R)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-4-methyldecan-3-imine |
|---|---|
| PubChem CID | 134876840 |
| Molecular Formula | C17H34N2O |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.27 |
| IUPAC Name | (E,4R)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-4-methyldecan-3-imine |
| SMILES | CCCCCC[C@@H](C)/C(CC)=N/N1CCC[C@H]1COC |
| InChI | InChI=1S/C17H34N2O/c1-5-7-8-9-11-15(3)17(6-2)18-19-13-10-12-16(19)14-20-4/h15-16H,5-14H2,1-4H3/b18-17+/t15-,16+/m1/s1 |
| InChIKey | YFQWQXMSZNKRJD-ILCIMCFISA-N |
| XLogP | 4.47 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|