C16H34N2OSi — CID 10913562
(E)-1-[tert-butyl(dimethyl)silyl]-N-[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]butan-2-imine (PubChem CID 10913562) has the molecular formula C16H34N2OSi and a molecular weight of 298.55 g/mol. Its IUPAC name is (E)-1-[tert-butyl(dimethyl)silyl]-N-[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]butan-2-imine.
| Compound Name | (E)-1-[tert-butyl(dimethyl)silyl]-N-[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]butan-2-imine |
|---|---|
| PubChem CID | 10913562 |
| Molecular Formula | C16H34N2OSi |
| Molecular Weight | 298.55 g/mol |
| Exact Mass | 298.24 |
| IUPAC Name | (E)-1-[tert-butyl(dimethyl)silyl]-N-[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]butan-2-imine |
| SMILES | CC/C(C[Si](C)(C)C(C)(C)C)=N\N1CCC[C@@H]1COC |
| InChI | InChI=1S/C16H34N2OSi/c1-8-14(13-20(6,7)16(2,3)4)17-18-11-9-10-15(18)12-19-5/h15H,8-13H2,1-7H3/b17-14+/t15-/m1/s1 |
| InChIKey | HUYJELOIKSRAMD-PWVLXBNSSA-N |
| XLogP | 4.37 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.55 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|