C17H36N2O2Si — CID 134876893
(E)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-4,5-dimethyl-4-trimethylsilyloxyhexan-2-imine (PubChem CID 134876893) has the molecular formula C17H36N2O2Si and a molecular weight of 328.57 g/mol. Its IUPAC name is (E)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-4,5-dimethyl-4-trimethylsilyloxyhexan-2-imine.
| Compound Name | (E)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-4,5-dimethyl-4-trimethylsilyloxyhexan-2-imine |
|---|---|
| PubChem CID | 134876893 |
| Molecular Formula | C17H36N2O2Si |
| Molecular Weight | 328.57 g/mol |
| Exact Mass | 328.25 |
| IUPAC Name | (E)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-4,5-dimethyl-4-trimethylsilyloxyhexan-2-imine |
| SMILES | COC[C@@H]1CCCN1/N=C(\C)CC(C)(O[Si](C)(C)C)C(C)C |
| InChI | InChI=1S/C17H36N2O2Si/c1-14(2)17(4,21-22(6,7)8)12-15(3)18-19-11-9-10-16(19)13-20-5/h14,16H,9-13H2,1-8H3/b18-15+/t16-,17?/m0/s1 |
| InChIKey | UIMJAISCKBHABI-XZUUYUHSSA-N |
| XLogP | 4.13 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.57 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|