C22H38N2OSi — CID 23241580
1-[tert-butyl(dimethyl)silyl]-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-4-phenylbutan-2-imine (PubChem CID 23241580) has the molecular formula C22H38N2OSi and a molecular weight of 374.65 g/mol. Its IUPAC name is 1-[tert-butyl(dimethyl)silyl]-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-4-phenylbutan-2-imine.
| Compound Name | 1-[tert-butyl(dimethyl)silyl]-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-4-phenylbutan-2-imine |
|---|---|
| PubChem CID | 23241580 |
| Molecular Formula | C22H38N2OSi |
| Molecular Weight | 374.65 g/mol |
| Exact Mass | 374.28 |
| IUPAC Name | 1-[tert-butyl(dimethyl)silyl]-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-4-phenylbutan-2-imine |
| SMILES | COC[C@@H]1CCCN1N=C(CCc1ccccc1)C[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H38N2OSi/c1-22(2,3)26(5,6)18-20(15-14-19-11-8-7-9-12-19)23-24-16-10-13-21(24)17-25-4/h7-9,11-12,21H,10,13-18H2,1-6H3/t21-/m0/s1 |
| InChIKey | ODXSVTKKYHPMHT-NRFANRHFSA-N |
| XLogP | 5.59 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.65 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|