C16H24N2O2 — CID 10956776
(E,2S)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2-phenylmethoxypropan-1-imine (PubChem CID 10956776) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is (E,2S)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2-phenylmethoxypropan-1-imine.
| Compound Name | (E,2S)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2-phenylmethoxypropan-1-imine |
|---|---|
| PubChem CID | 10956776 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | (E,2S)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2-phenylmethoxypropan-1-imine |
| SMILES | COC[C@@H]1CCCN1/N=C/[C@H](C)OCc1ccccc1 |
| InChI | InChI=1S/C16H24N2O2/c1-14(20-12-15-7-4-3-5-8-15)11-17-18-10-6-9-16(18)13-19-2/h3-5,7-8,11,14,16H,6,9-10,12-13H2,1-2H3/b17-11+/t14-,16-/m0/s1 |
| InChIKey | IBSNTSJSCJOLBE-AHEZAYJZSA-N |
| XLogP | 2.69 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|