C13H24N2O3 — CID 10978077
[(1E)-1-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]imino-3-methylbutan-2-yl] acetate (PubChem CID 10978077) has the molecular formula C13H24N2O3 and a molecular weight of 256.35 g/mol. Its IUPAC name is [(1E)-1-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]imino-3-methylbutan-2-yl] acetate.
| Compound Name | [(1E)-1-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]imino-3-methylbutan-2-yl] acetate |
|---|---|
| PubChem CID | 10978077 |
| Molecular Formula | C13H24N2O3 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | [(1E)-1-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]imino-3-methylbutan-2-yl] acetate |
| SMILES | COC[C@@H]1CCCN1/N=C/C(OC(C)=O)C(C)C |
| InChI | InChI=1S/C13H24N2O3/c1-10(2)13(18-11(3)16)8-14-15-7-5-6-12(15)9-17-4/h8,10,12-13H,5-7,9H2,1-4H3/b14-8+/t12-,13?/m0/s1 |
| InChIKey | LTRWSQWYTAFUED-HIQRDJRCSA-N |
| XLogP | 1.67 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|