About ethane;propan-2-yl (2S)-2-(methoxymethyl)pyrrolidine-1-carboxylate
ethane;propan-2-yl (2S)-2-(methoxymethyl)pyrrolidine-1-carboxylate (PubChem CID 143059682) has the molecular formula C12H25NO3
and a molecular weight of 231.34 g/mol. Its IUPAC name is ethane;propan-2-yl (2S)-2-(methoxymethyl)pyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | ethane;propan-2-yl (2S)-2-(methoxymethyl)pyrrolidine-1-carboxylate |
| PubChem CID | 143059682 |
| Molecular Formula | C12H25NO3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.18 |
| IUPAC Name | ethane;propan-2-yl (2S)-2-(methoxymethyl)pyrrolidine-1-carboxylate |
| SMILES | CC.COC[C@@H]1CCCN1C(=O)OC(C)C |
| InChI | InChI=1S/C10H19NO3.C2H6/c1-8(2)14-10(12)11-6-4-5-9(11)7-13-3;1-2/h8-9H,4-7H2,1-3H3;1-2H3/t9-;/m0./s1 |
| InChIKey | WZSAHMSMGBVSIV-FVGYRXGTSA-N |
| XLogP | 2.67 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;propan-2-yl (2S)-2-(methoxymethyl)pyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;propan-2-yl (2S)-2-(methoxymethyl)pyrrolidine-1-carboxylate?
The IUPAC name of ethane;propan-2-yl (2S)-2-(methoxymethyl)pyrrolidine-1-carboxylate (CID 143059682) is ethane;propan-2-yl (2S)-2-(methoxymethyl)pyrrolidine-1-carboxylate.
What is the SMILES notation for ethane;propan-2-yl (2S)-2-(methoxymethyl)pyrrolidine-1-carboxylate?
The canonical SMILES for ethane;propan-2-yl (2S)-2-(methoxymethyl)pyrrolidine-1-carboxylate is CC.COC[C@@H]1CCCN1C(=O)OC(C)C.
What is the InChIKey of ethane;propan-2-yl (2S)-2-(methoxymethyl)pyrrolidine-1-carboxylate?
The InChIKey is WZSAHMSMGBVSIV-FVGYRXGTSA-N. The full InChI is InChI=1S/C10H19NO3.C2H6/c1-8(2)14-10(12)11-6-4-5-9(11)7-13-3;1-2/h8-9H,4-7H2,1-3H3;1-2H3/t9-;/m0./s1.
What are the key properties of ethane;propan-2-yl (2S)-2-(methoxymethyl)pyrrolidine-1-carboxylate?
ethane;propan-2-yl (2S)-2-(methoxymethyl)pyrrolidine-1-carboxylate has a molecular weight of 231.34 g/mol, XLogP of 2.67, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;propan-2-yl (2S)-2-(methoxymethyl)pyrrolidine-1-carboxylate is sourced from PubChem (CID 143059682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).