C11H25BNO6P — CID 166480351
CID 166480351 (PubChem CID 166480351) has the molecular formula C11H25BNO6P and a molecular weight of 309.11 g/mol.
| Compound Name | CID 166480351 |
|---|---|
| PubChem CID | 166480351 |
| Molecular Formula | C11H25BNO6P |
| Molecular Weight | 309.11 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | — |
| SMILES | CC.COP(=O)(O)O.[B]CC(=O)N1CCCC1COC |
| InChI | InChI=1S/C8H14BNO2.C2H6.CH5O4P/c1-12-6-7-3-2-4-10(7)8(11)5-9;1-2;1-5-6(2,3)4/h7H,2-6H2,1H3;1-2H3;1H3,(H2,2,3,4) |
| InChIKey | AZJMAXWSIKNSFO-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.11 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|