C17H30N2O3 — CID 70315088
N-[1-cyclohexyl-2-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2-oxoethyl]propanamide (PubChem CID 70315088) has the molecular formula C17H30N2O3 and a molecular weight of 310.44 g/mol. Its IUPAC name is N-[1-cyclohexyl-2-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2-oxoethyl]propanamide.
| Compound Name | N-[1-cyclohexyl-2-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2-oxoethyl]propanamide |
|---|---|
| PubChem CID | 70315088 |
| Molecular Formula | C17H30N2O3 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | N-[1-cyclohexyl-2-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2-oxoethyl]propanamide |
| SMILES | CCC(=O)NC(C(=O)N1CCC[C@H]1COC)C1CCCCC1 |
| InChI | InChI=1S/C17H30N2O3/c1-3-15(20)18-16(13-8-5-4-6-9-13)17(21)19-11-7-10-14(19)12-22-2/h13-14,16H,3-12H2,1-2H3,(H,18,20)/t14-,16?/m0/s1 |
| InChIKey | YLNCMLUXKAZLAB-LBAUFKAWSA-N |
| XLogP | 2.10 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |