C14H30N2OSi — CID 23241582
N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2-triethylsilylethanimine (PubChem CID 23241582) has the molecular formula C14H30N2OSi and a molecular weight of 270.49 g/mol. Its IUPAC name is N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2-triethylsilylethanimine.
| Compound Name | N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2-triethylsilylethanimine |
|---|---|
| PubChem CID | 23241582 |
| Molecular Formula | C14H30N2OSi |
| Molecular Weight | 270.49 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2-triethylsilylethanimine |
| SMILES | CC[Si](CC)(CC)CC=NN1CCC[C@H]1COC |
| InChI | InChI=1S/C14H30N2OSi/c1-5-18(6-2,7-3)12-10-15-16-11-8-9-14(16)13-17-4/h10,14H,5-9,11-13H2,1-4H3/t14-/m0/s1 |
| InChIKey | JTLOCORAZXMAQZ-AWEZNQCLSA-N |
| XLogP | 3.59 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.49 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|