C17H32N4O2 — CID 10892701
(E)-N,N'-bis[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]pentane-1,5-diimine (PubChem CID 10892701) has the molecular formula C17H32N4O2 and a molecular weight of 324.47 g/mol. Its IUPAC name is (E)-N,N'-bis[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]pentane-1,5-diimine.
| Compound Name | (E)-N,N'-bis[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]pentane-1,5-diimine |
|---|---|
| PubChem CID | 10892701 |
| Molecular Formula | C17H32N4O2 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.25 |
| IUPAC Name | (E)-N,N'-bis[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]pentane-1,5-diimine |
| SMILES | COC[C@@H]1CCCN1/N=C/CCC/C=N/N1CCC[C@H]1COC |
| InChI | InChI=1S/C17H32N4O2/c1-22-14-16-8-6-12-20(16)18-10-4-3-5-11-19-21-13-7-9-17(21)15-23-2/h10-11,16-17H,3-9,12-15H2,1-2H3/b18-10+,19-11+/t16-,17-/m0/s1 |
| InChIKey | FIUZCZLUVDYOGV-DAGMDEONSA-N |
| XLogP | 2.35 |
| TPSA | 49.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|