C16H30N2O — CID 101088592
4-tert-butyl-N-[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]cyclohexan-1-imine (PubChem CID 101088592) has the molecular formula C16H30N2O and a molecular weight of 266.43 g/mol. Its IUPAC name is 4-tert-butyl-N-[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]cyclohexan-1-imine.
| Compound Name | 4-tert-butyl-N-[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]cyclohexan-1-imine |
|---|---|
| PubChem CID | 101088592 |
| Molecular Formula | C16H30N2O |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.24 |
| IUPAC Name | 4-tert-butyl-N-[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]cyclohexan-1-imine |
| SMILES | COC[C@H]1CCCN1N=C1CCC(C(C)(C)C)CC1 |
| InChI | InChI=1S/C16H30N2O/c1-16(2,3)13-7-9-14(10-8-13)17-18-11-5-6-15(18)12-19-4/h13,15H,5-12H2,1-4H3/b17-14-/t13?,15-/m1/s1 |
| InChIKey | JDUFTLILAKSALW-OYKVUIGXSA-N |
| XLogP | 3.69 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|