C17H25N3O — CID 173367055
(E)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2-pyridin-3-ylcyclohexan-1-imine (PubChem CID 173367055) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is (E)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2-pyridin-3-ylcyclohexan-1-imine.
| Compound Name | (E)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2-pyridin-3-ylcyclohexan-1-imine |
|---|---|
| PubChem CID | 173367055 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | (E)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2-pyridin-3-ylcyclohexan-1-imine |
| SMILES | COC[C@@H]1CCCN1/N=C1\CCCCC1c1cccnc1 |
| InChI | InChI=1S/C17H25N3O/c1-21-13-15-7-5-11-20(15)19-17-9-3-2-8-16(17)14-6-4-10-18-12-14/h4,6,10,12,15-16H,2-3,5,7-9,11,13H2,1H3/b19-17+/t15-,16?/m0/s1 |
| InChIKey | XRWUKJHETPKNRF-AISNPFJRSA-N |
| XLogP | 3.21 |
| TPSA | 37.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|