C11H16N2 — CID 118883076
3-(1-methylpiperidin-3-yl)pyridine (PubChem CID 118883076) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 3-(1-methylpiperidin-3-yl)pyridine.
| Compound Name | 3-(1-methylpiperidin-3-yl)pyridine |
|---|---|
| PubChem CID | 118883076 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 3-(1-methylpiperidin-3-yl)pyridine |
| SMILES | CN1CCCC(c2cccnc2)C1 |
| InChI | InChI=1S/C11H16N2/c1-13-7-3-5-11(9-13)10-4-2-6-12-8-10/h2,4,6,8,11H,3,5,7,9H2,1H3 |
| InChIKey | XQFFNTPXCWCDQJ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |