C18H26N2O3S — CID 15034229
methyl (2R)-2-[(E)-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]iminomethyl]-2-phenylsulfanylbutanoate (PubChem CID 15034229) has the molecular formula C18H26N2O3S and a molecular weight of 350.48 g/mol. Its IUPAC name is methyl (2R)-2-[(E)-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]iminomethyl]-2-phenylsulfanylbutanoate.
| Compound Name | methyl (2R)-2-[(E)-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]iminomethyl]-2-phenylsulfanylbutanoate |
|---|---|
| PubChem CID | 15034229 |
| Molecular Formula | C18H26N2O3S |
| Molecular Weight | 350.48 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | methyl (2R)-2-[(E)-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]iminomethyl]-2-phenylsulfanylbutanoate |
| SMILES | CC[C@](/C=N/N1CCC[C@H]1COC)(Sc1ccccc1)C(=O)OC |
| InChI | InChI=1S/C18H26N2O3S/c1-4-18(17(21)23-3,24-16-10-6-5-7-11-16)14-19-20-12-8-9-15(20)13-22-2/h5-7,10-11,14-15H,4,8-9,12-13H2,1-3H3/b19-14+/t15-,18+/m0/s1 |
| InChIKey | NWHGIZCPVJANFD-RGPDEAODSA-N |
| XLogP | 3.20 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.48 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|