C19H29BrN2OS — CID 11165857
(E,2S)-3-(4-bromophenyl)-2-tert-butylsulfanyl-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]propan-1-imine (PubChem CID 11165857) has the molecular formula C19H29BrN2OS and a molecular weight of 413.43 g/mol. Its IUPAC name is (E,2S)-3-(4-bromophenyl)-2-tert-butylsulfanyl-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]propan-1-imine.
| Compound Name | (E,2S)-3-(4-bromophenyl)-2-tert-butylsulfanyl-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]propan-1-imine |
|---|---|
| PubChem CID | 11165857 |
| Molecular Formula | C19H29BrN2OS |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | (E,2S)-3-(4-bromophenyl)-2-tert-butylsulfanyl-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]propan-1-imine |
| SMILES | COC[C@@H]1CCCN1/N=C/[C@H](Cc1ccc(Br)cc1)SC(C)(C)C |
| InChI | InChI=1S/C19H29BrN2OS/c1-19(2,3)24-18(12-15-7-9-16(20)10-8-15)13-21-22-11-5-6-17(22)14-23-4/h7-10,13,17-18H,5-6,11-12,14H2,1-4H3/b21-13+/t17-,18-/m0/s1 |
| InChIKey | LLPHQEOLRWWHBZ-PMOZRXSBSA-N |
| XLogP | 4.99 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|