C15H18BrNO2S2 — CID 15315155
[2-(4-bromophenyl)-2-oxoethyl] (2R)-2-(methoxymethyl)pyrrolidine-1-carbodithioate (PubChem CID 15315155) has the molecular formula C15H18BrNO2S2 and a molecular weight of 388.35 g/mol. Its IUPAC name is [2-(4-bromophenyl)-2-oxoethyl] (2R)-2-(methoxymethyl)pyrrolidine-1-carbodithioate.
| Compound Name | [2-(4-bromophenyl)-2-oxoethyl] (2R)-2-(methoxymethyl)pyrrolidine-1-carbodithioate |
|---|---|
| PubChem CID | 15315155 |
| Molecular Formula | C15H18BrNO2S2 |
| Molecular Weight | 388.35 g/mol |
| Exact Mass | 387.00 |
| IUPAC Name | [2-(4-bromophenyl)-2-oxoethyl] (2R)-2-(methoxymethyl)pyrrolidine-1-carbodithioate |
| SMILES | COC[C@H]1CCCN1C(=S)SCC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H18BrNO2S2/c1-19-9-13-3-2-8-17(13)15(20)21-10-14(18)11-4-6-12(16)7-5-11/h4-7,13H,2-3,8-10H2,1H3/t13-/m1/s1 |
| InChIKey | SIXGMBLBYQWMGE-CYBMUJFWSA-N |
| XLogP | 3.76 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.35 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|