C19H24N2O — CID 177476484
(Z)-1-cyclopenta-1,3-dien-1-yl-N-[2-(methoxymethyl)pyrrolidin-1-yl]-2-phenylethanimine (PubChem CID 177476484) has the molecular formula C19H24N2O and a molecular weight of 296.41 g/mol. Its IUPAC name is (Z)-1-cyclopenta-1,3-dien-1-yl-N-[2-(methoxymethyl)pyrrolidin-1-yl]-2-phenylethanimine.
| Compound Name | (Z)-1-cyclopenta-1,3-dien-1-yl-N-[2-(methoxymethyl)pyrrolidin-1-yl]-2-phenylethanimine |
|---|---|
| PubChem CID | 177476484 |
| Molecular Formula | C19H24N2O |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | (Z)-1-cyclopenta-1,3-dien-1-yl-N-[2-(methoxymethyl)pyrrolidin-1-yl]-2-phenylethanimine |
| SMILES | COCC1CCCN1/N=C(/Cc1ccccc1)C1=CC=CC1 |
| InChI | InChI=1S/C19H24N2O/c1-22-15-18-12-7-13-21(18)20-19(17-10-5-6-11-17)14-16-8-3-2-4-9-16/h2-6,8-10,18H,7,11-15H2,1H3/b20-19- |
| InChIKey | UVUFNMFIMSQYEP-VXPUYCOJSA-N |
| XLogP | 3.58 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|