C20H28FeN2O+2 — CID 10809024
CID 10809024 (PubChem CID 10809024) has the molecular formula C20H28FeN2O+2 and a molecular weight of 368.30 g/mol.
| Compound Name | CID 10809024 |
|---|---|
| PubChem CID | 10809024 |
| Molecular Formula | C20H28FeN2O+2 |
| Molecular Weight | 368.30 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | — |
| SMILES | COC[C@@H]1CCCN1/N=C(\[C]1[CH][CH][CH][CH]1)C(C)C.[CH]1[CH][CH][CH][CH]1.[Fe+2] |
| InChI | InChI=1S/C15H23N2O.C5H5.Fe/c1-12(2)15(13-7-4-5-8-13)16-17-10-6-9-14(17)11-18-3;1-2-4-5-3-1;/h4-5,7-8,12,14H,6,9-11H2,1-3H3;1-5H;/q;;+2/b16-15-;;/t14-;;/m0../s1 |
| InChIKey | QUSPWWMMNKYKRN-GJSHEOMYSA-N |
| XLogP | 3.53 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.30 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|