C24H33N3O3S — CID 177436208
N-[(3S,4Z)-4-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]imino-3-methyl-4-phenylbutyl]-4-methylbenzenesulfonamide (PubChem CID 177436208) has the molecular formula C24H33N3O3S and a molecular weight of 443.61 g/mol. Its IUPAC name is N-[(3S,4Z)-4-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]imino-3-methyl-4-phenylbutyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(3S,4Z)-4-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]imino-3-methyl-4-phenylbutyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 177436208 |
| Molecular Formula | C24H33N3O3S |
| Molecular Weight | 443.61 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | N-[(3S,4Z)-4-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]imino-3-methyl-4-phenylbutyl]-4-methylbenzenesulfonamide |
| SMILES | COC[C@@H]1CCCN1/N=C(\c1ccccc1)[C@@H](C)CCNS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H33N3O3S/c1-19-11-13-23(14-12-19)31(28,29)25-16-15-20(2)24(21-8-5-4-6-9-21)26-27-17-7-10-22(27)18-30-3/h4-6,8-9,11-14,20,22,25H,7,10,15-18H2,1-3H3/b26-24-/t20-,22-/m0/s1 |
| InChIKey | CGKFBPIYXPUQJG-GCKZEECHSA-N |
| XLogP | 3.81 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.61 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|