About CID 10925908
CID 10925908 (PubChem CID 10925908) has the molecular formula C13H21N2O
and a molecular weight of 221.32 g/mol.
Molecular Properties
| Compound Name | CID 10925908 |
| PubChem CID | 10925908 |
| Molecular Formula | C13H21N2O |
| Molecular Weight | 221.32 g/mol |
| Exact Mass | 221.17 |
| IUPAC Name | — |
| SMILES | COC[C@@H]1CCCN1N[C@H](C)[C]1[CH][CH][CH][CH]1 |
| InChI | InChI=1S/C13H21N2O/c1-11(12-6-3-4-7-12)14-15-9-5-8-13(15)10-16-2/h3-4,6-7,11,13-14H,5,8-10H2,1-2H3/t11-,13+/m1/s1 |
| InChIKey | UCEDAVWDNHYREX-YPMHNXCESA-N |
| XLogP | 1.40 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.32 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 10925908 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 10925908?
The IUPAC name of CID 10925908 (CID 10925908) is not available.
What is the SMILES notation for CID 10925908?
The canonical SMILES for CID 10925908 is COC[C@@H]1CCCN1N[C@H](C)[C]1[CH][CH][CH][CH]1.
What is the InChIKey of CID 10925908?
The InChIKey is UCEDAVWDNHYREX-YPMHNXCESA-N. The full InChI is InChI=1S/C13H21N2O/c1-11(12-6-3-4-7-12)14-15-9-5-8-13(15)10-16-2/h3-4,6-7,11,13-14H,5,8-10H2,1-2H3/t11-,13+/m1/s1.
What are the key properties of CID 10925908?
CID 10925908 has a molecular weight of 221.32 g/mol, XLogP of 1.40, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 10925908 is sourced from PubChem (CID 10925908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).