C13H21N2O — CID 10925908
CID 10925908 (PubChem CID 10925908) has the molecular formula C13H21N2O and a molecular weight of 221.32 g/mol.
| Compound Name | CID 10925908 |
|---|---|
| PubChem CID | 10925908 |
| Molecular Formula | C13H21N2O |
| Molecular Weight | 221.32 g/mol |
| Exact Mass | 221.17 |
| IUPAC Name | — |
| SMILES | COC[C@@H]1CCCN1N[C@H](C)[C]1[CH][CH][CH][CH]1 |
| InChI | InChI=1S/C13H21N2O/c1-11(12-6-3-4-7-12)14-15-9-5-8-13(15)10-16-2/h3-4,6-7,11,13-14H,5,8-10H2,1-2H3/t11-,13+/m1/s1 |
| InChIKey | UCEDAVWDNHYREX-YPMHNXCESA-N |
| XLogP | 1.40 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.32 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |