C32H54FeN4O2+2 — CID 10875591
CID 10875591 (PubChem CID 10875591) has the molecular formula C32H54FeN4O2+2 and a molecular weight of 582.66 g/mol.
| Compound Name | CID 10875591 |
|---|---|
| PubChem CID | 10875591 |
| Molecular Formula | C32H54FeN4O2+2 |
| Molecular Weight | 582.66 g/mol |
| Exact Mass | 582.36 |
| IUPAC Name | — |
| SMILES | CCCC[C@@H](NN1CCC[C@H]1COC)[C]1[CH][CH][CH][CH]1.CCCC[C@@H](NN1CCC[C@H]1COC)[C]1[CH][CH][CH][CH]1.[Fe+2] |
| InChI | InChI=1S/2C16H27N2O.Fe/c2*1-3-4-11-16(14-8-5-6-9-14)17-18-12-7-10-15(18)13-19-2;/h2*5-6,8-9,15-17H,3-4,7,10-13H2,1-2H3;/q;;+2/t2*15-,16+;/m00./s1 |
| InChIKey | XXUHNPCLYYCJNL-VSPZJNGSSA-N |
| XLogP | 5.13 |
| TPSA | 49.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.66 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|