C20H42N2O2Si — CID 134876655
(Z)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2,2,6,6-tetramethyl-5-trimethylsilyloxyheptan-3-imine (PubChem CID 134876655) has the molecular formula C20H42N2O2Si and a molecular weight of 370.65 g/mol. Its IUPAC name is (Z)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2,2,6,6-tetramethyl-5-trimethylsilyloxyheptan-3-imine.
| Compound Name | (Z)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2,2,6,6-tetramethyl-5-trimethylsilyloxyheptan-3-imine |
|---|---|
| PubChem CID | 134876655 |
| Molecular Formula | C20H42N2O2Si |
| Molecular Weight | 370.65 g/mol |
| Exact Mass | 370.30 |
| IUPAC Name | (Z)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2,2,6,6-tetramethyl-5-trimethylsilyloxyheptan-3-imine |
| SMILES | COC[C@@H]1CCCN1/N=C(/CC(O[Si](C)(C)C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C20H42N2O2Si/c1-19(2,3)17(21-22-13-11-12-16(22)15-23-7)14-18(20(4,5)6)24-25(8,9)10/h16,18H,11-15H2,1-10H3/b21-17-/t16-,18?/m0/s1 |
| InChIKey | CTUMMUAFPLWJPL-KLPPQIECSA-N |
| XLogP | 5.16 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.65 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|