C27H58N2O3Si2 — CID 15722700
(4S,6S)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-4,6-dipropyl-1,9-bis(trimethylsilyloxy)nonan-5-imine (PubChem CID 15722700) has the molecular formula C27H58N2O3Si2 and a molecular weight of 514.94 g/mol. Its IUPAC name is (4S,6S)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-4,6-dipropyl-1,9-bis(trimethylsilyloxy)nonan-5-imine.
| Compound Name | (4S,6S)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-4,6-dipropyl-1,9-bis(trimethylsilyloxy)nonan-5-imine |
|---|---|
| PubChem CID | 15722700 |
| Molecular Formula | C27H58N2O3Si2 |
| Molecular Weight | 514.94 g/mol |
| Exact Mass | 514.40 |
| IUPAC Name | (4S,6S)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-4,6-dipropyl-1,9-bis(trimethylsilyloxy)nonan-5-imine |
| SMILES | CCC[C@@H](CCCO[Si](C)(C)C)C(=NN1CCC[C@H]1COC)[C@@H](CCC)CCCO[Si](C)(C)C |
| InChI | InChI=1S/C27H58N2O3Si2/c1-10-15-24(17-13-21-31-33(4,5)6)27(28-29-20-12-19-26(29)23-30-3)25(16-11-2)18-14-22-32-34(7,8)9/h24-26H,10-23H2,1-9H3/t24-,25-,26-/m0/s1 |
| InChIKey | VKLZKKRDSFZIRJ-GSDHBNRESA-N |
| XLogP | 7.55 |
| TPSA | 43.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.94 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|