C21H43N2O4P — CID 177436167
(Z,5S)-5-[(1R)-1-diethoxyphosphorylethyl]-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2,6-dimethylheptan-3-imine (PubChem CID 177436167) has the molecular formula C21H43N2O4P and a molecular weight of 418.56 g/mol. Its IUPAC name is (Z,5S)-5-[(1R)-1-diethoxyphosphorylethyl]-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2,6-dimethylheptan-3-imine.
| Compound Name | (Z,5S)-5-[(1R)-1-diethoxyphosphorylethyl]-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2,6-dimethylheptan-3-imine |
|---|---|
| PubChem CID | 177436167 |
| Molecular Formula | C21H43N2O4P |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.30 |
| IUPAC Name | (Z,5S)-5-[(1R)-1-diethoxyphosphorylethyl]-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2,6-dimethylheptan-3-imine |
| SMILES | CCOP(=O)(OCC)[C@H](C)[C@@H](C/C(=N/N1CCC[C@H]1COC)C(C)C)C(C)C |
| InChI | InChI=1S/C21H43N2O4P/c1-9-26-28(24,27-10-2)18(7)20(16(3)4)14-21(17(5)6)22-23-13-11-12-19(23)15-25-8/h16-20H,9-15H2,1-8H3/b22-21-/t18-,19+,20+/m1/s1 |
| InChIKey | MDVXSPHUESGJKP-KTKVWRPZSA-N |
| XLogP | 5.43 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|