C19H38N2O3 — CID 11279331
(E,4S,6S,7S)-7-(methoxymethoxy)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-4,6-dimethylnonan-3-imine (PubChem CID 11279331) has the molecular formula C19H38N2O3 and a molecular weight of 342.52 g/mol. Its IUPAC name is (E,4S,6S,7S)-7-(methoxymethoxy)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-4,6-dimethylnonan-3-imine.
| Compound Name | (E,4S,6S,7S)-7-(methoxymethoxy)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-4,6-dimethylnonan-3-imine |
|---|---|
| PubChem CID | 11279331 |
| Molecular Formula | C19H38N2O3 |
| Molecular Weight | 342.52 g/mol |
| Exact Mass | 342.29 |
| IUPAC Name | (E,4S,6S,7S)-7-(methoxymethoxy)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-4,6-dimethylnonan-3-imine |
| SMILES | CC/C(=N\N1CCC[C@H]1COC)[C@@H](C)C[C@H](C)[C@H](CC)OCOC |
| InChI | InChI=1S/C19H38N2O3/c1-7-18(20-21-11-9-10-17(21)13-22-5)15(3)12-16(4)19(8-2)24-14-23-6/h15-17,19H,7-14H2,1-6H3/b20-18+/t15-,16-,17-,19-/m0/s1 |
| InChIKey | DLBMWGWNUKJQHF-UAJLTXLBSA-N |
| XLogP | 3.92 |
| TPSA | 43.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.52 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|