C22H48N2O3Si2 — CID 44631189
(3S,5S)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-3,5-dimethyl-1,8-bis(trimethylsilyloxy)octan-4-imine (PubChem CID 44631189) has the molecular formula C22H48N2O3Si2 and a molecular weight of 444.81 g/mol. Its IUPAC name is (3S,5S)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-3,5-dimethyl-1,8-bis(trimethylsilyloxy)octan-4-imine.
| Compound Name | (3S,5S)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-3,5-dimethyl-1,8-bis(trimethylsilyloxy)octan-4-imine |
|---|---|
| PubChem CID | 44631189 |
| Molecular Formula | C22H48N2O3Si2 |
| Molecular Weight | 444.81 g/mol |
| Exact Mass | 444.32 |
| IUPAC Name | (3S,5S)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-3,5-dimethyl-1,8-bis(trimethylsilyloxy)octan-4-imine |
| SMILES | COC[C@@H]1CCCN1N=C([C@@H](C)CCCO[Si](C)(C)C)[C@@H](C)CCO[Si](C)(C)C |
| InChI | InChI=1S/C22H48N2O3Si2/c1-19(12-11-16-26-28(4,5)6)22(20(2)14-17-27-29(7,8)9)23-24-15-10-13-21(24)18-25-3/h19-21H,10-18H2,1-9H3/t19-,20-,21-/m0/s1 |
| InChIKey | XVMLEVLHXZENJP-ACRUOGEOSA-N |
| XLogP | 5.60 |
| TPSA | 43.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.81 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|