C15H26N2O3 — CID 11832884
(3S,4R)-4-[(E)-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]iminomethyl]-3-propyloxan-2-one (PubChem CID 11832884) has the molecular formula C15H26N2O3 and a molecular weight of 282.38 g/mol. Its IUPAC name is (3S,4R)-4-[(E)-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]iminomethyl]-3-propyloxan-2-one.
| Compound Name | (3S,4R)-4-[(E)-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]iminomethyl]-3-propyloxan-2-one |
|---|---|
| PubChem CID | 11832884 |
| Molecular Formula | C15H26N2O3 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | (3S,4R)-4-[(E)-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]iminomethyl]-3-propyloxan-2-one |
| SMILES | CCC[C@@H]1C(=O)OCC[C@H]1/C=N/N1CCC[C@H]1COC |
| InChI | InChI=1S/C15H26N2O3/c1-3-5-14-12(7-9-20-15(14)18)10-16-17-8-4-6-13(17)11-19-2/h10,12-14H,3-9,11H2,1-2H3/b16-10+/t12-,13-,14-/m0/s1 |
| InChIKey | GONQNWRRFPWVBJ-YATQOYNPSA-N |
| XLogP | 2.06 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|