C19H34N2O2 — CID 11110082
N-hexa-1,5-dien-3-yl-1-[(2S)-2-(2-methoxyethoxymethyl)pyrrolidin-1-yl]-2,2-dimethylpropan-1-imine (PubChem CID 11110082) has the molecular formula C19H34N2O2 and a molecular weight of 322.49 g/mol. Its IUPAC name is N-hexa-1,5-dien-3-yl-1-[(2S)-2-(2-methoxyethoxymethyl)pyrrolidin-1-yl]-2,2-dimethylpropan-1-imine.
| Compound Name | N-hexa-1,5-dien-3-yl-1-[(2S)-2-(2-methoxyethoxymethyl)pyrrolidin-1-yl]-2,2-dimethylpropan-1-imine |
|---|---|
| PubChem CID | 11110082 |
| Molecular Formula | C19H34N2O2 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.26 |
| IUPAC Name | N-hexa-1,5-dien-3-yl-1-[(2S)-2-(2-methoxyethoxymethyl)pyrrolidin-1-yl]-2,2-dimethylpropan-1-imine |
| SMILES | C=CCC(C=C)/N=C(/N1CCC[C@H]1COCCOC)C(C)(C)C |
| InChI | InChI=1S/C19H34N2O2/c1-7-10-16(8-2)20-18(19(3,4)5)21-12-9-11-17(21)15-23-14-13-22-6/h7-8,16-17H,1-2,9-15H2,3-6H3/b20-18+/t16?,17-/m0/s1 |
| InChIKey | RZOPNPQNBONQDG-KKAKNGJASA-N |
| XLogP | 3.69 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|