C17H32N2O — CID 15308913
N-hex-1-en-3-yl-1-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2,2-dimethylpropan-1-imine (PubChem CID 15308913) has the molecular formula C17H32N2O and a molecular weight of 280.46 g/mol. Its IUPAC name is N-hex-1-en-3-yl-1-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2,2-dimethylpropan-1-imine.
| Compound Name | N-hex-1-en-3-yl-1-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2,2-dimethylpropan-1-imine |
|---|---|
| PubChem CID | 15308913 |
| Molecular Formula | C17H32N2O |
| Molecular Weight | 280.46 g/mol |
| Exact Mass | 280.25 |
| IUPAC Name | N-hex-1-en-3-yl-1-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2,2-dimethylpropan-1-imine |
| SMILES | C=CC(CCC)/N=C(/N1CCC[C@H]1COC)C(C)(C)C |
| InChI | InChI=1S/C17H32N2O/c1-7-10-14(8-2)18-16(17(3,4)5)19-12-9-11-15(19)13-20-6/h8,14-15H,2,7,9-13H2,1,3-6H3/b18-16+/t14?,15-/m0/s1 |
| InChIKey | CGKRMEDWWZJDRI-DGCGIPQCSA-N |
| XLogP | 3.90 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.46 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|