C12H22N2O3 — CID 145466754
3-amino-1-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]hexane-1,2-dione (PubChem CID 145466754) has the molecular formula C12H22N2O3 and a molecular weight of 242.32 g/mol. Its IUPAC name is 3-amino-1-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]hexane-1,2-dione.
| Compound Name | 3-amino-1-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]hexane-1,2-dione |
|---|---|
| PubChem CID | 145466754 |
| Molecular Formula | C12H22N2O3 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | 3-amino-1-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]hexane-1,2-dione |
| SMILES | CCCC(N)C(=O)C(=O)N1CCC[C@H]1COC |
| InChI | InChI=1S/C12H22N2O3/c1-3-5-10(13)11(15)12(16)14-7-4-6-9(14)8-17-2/h9-10H,3-8,13H2,1-2H3/t9-,10?/m0/s1 |
| InChIKey | LJDOPTJFOQMJEF-RGURZIINSA-N |
| XLogP | 0.32 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|