C15H25NO4 — CID 143479480
methyl (3R)-3-[2-(prop-2-enoxymethyl)pyrrolidine-1-carbonyl]pentanoate (PubChem CID 143479480) has the molecular formula C15H25NO4 and a molecular weight of 283.37 g/mol. Its IUPAC name is methyl (3R)-3-[2-(prop-2-enoxymethyl)pyrrolidine-1-carbonyl]pentanoate.
| Compound Name | methyl (3R)-3-[2-(prop-2-enoxymethyl)pyrrolidine-1-carbonyl]pentanoate |
|---|---|
| PubChem CID | 143479480 |
| Molecular Formula | C15H25NO4 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | methyl (3R)-3-[2-(prop-2-enoxymethyl)pyrrolidine-1-carbonyl]pentanoate |
| SMILES | C=CCOCC1CCCN1C(=O)[C@H](CC)CC(=O)OC |
| InChI | InChI=1S/C15H25NO4/c1-4-9-20-11-13-7-6-8-16(13)15(18)12(5-2)10-14(17)19-3/h4,12-13H,1,5-11H2,2-3H3/t12-,13?/m1/s1 |
| InChIKey | IOMRYAOFSINIQC-PZORYLMUSA-N |
| XLogP | 1.77 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|