C24H28NOP — CID 70940383
[5-[[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]methyl]cyclopenta-1,3-dien-1-yl]-diphenylphosphane (PubChem CID 70940383) has the molecular formula C24H28NOP and a molecular weight of 377.47 g/mol. Its IUPAC name is [5-[[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]methyl]cyclopenta-1,3-dien-1-yl]-diphenylphosphane.
| Compound Name | [5-[[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]methyl]cyclopenta-1,3-dien-1-yl]-diphenylphosphane |
|---|---|
| PubChem CID | 70940383 |
| Molecular Formula | C24H28NOP |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | [5-[[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]methyl]cyclopenta-1,3-dien-1-yl]-diphenylphosphane |
| SMILES | COC[C@@H]1CCCN1CC1C=CC=C1P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H28NOP/c1-26-19-21-11-9-17-25(21)18-20-10-8-16-24(20)27(22-12-4-2-5-13-22)23-14-6-3-7-15-23/h2-8,10,12-16,20-21H,9,11,17-19H2,1H3/t20?,21-/m0/s1 |
| InChIKey | BRHJMUBXTIKZAJ-LBAQZLPGSA-N |
| XLogP | 4.30 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|