C13H20BNO3 — CID 71150761
[2-[[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]methyl]phenyl]boronic acid (PubChem CID 71150761) has the molecular formula C13H20BNO3 and a molecular weight of 249.12 g/mol. Its IUPAC name is [2-[[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]methyl]phenyl]boronic acid.
| Compound Name | [2-[[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 71150761 |
| Molecular Formula | C13H20BNO3 |
| Molecular Weight | 249.12 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | [2-[[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]methyl]phenyl]boronic acid |
| SMILES | COC[C@H]1CCCN1Cc1ccccc1B(O)O |
| InChI | InChI=1S/C13H20BNO3/c1-18-10-12-6-4-8-15(12)9-11-5-2-3-7-13(11)14(16)17/h2-3,5,7,12,16-17H,4,6,8-10H2,1H3/t12-/m1/s1 |
| InChIKey | VGUADOPWZNJDCI-GFCCVEGCSA-N |
| XLogP | -0.02 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.12 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|