C13H18BrN — CID 80668518
2-(bromomethyl)-1-[(2-methylphenyl)methyl]pyrrolidine (PubChem CID 80668518) has the molecular formula C13H18BrN and a molecular weight of 268.20 g/mol. Its IUPAC name is 2-(bromomethyl)-1-[(2-methylphenyl)methyl]pyrrolidine.
| Compound Name | 2-(bromomethyl)-1-[(2-methylphenyl)methyl]pyrrolidine |
|---|---|
| PubChem CID | 80668518 |
| Molecular Formula | C13H18BrN |
| Molecular Weight | 268.20 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 2-(bromomethyl)-1-[(2-methylphenyl)methyl]pyrrolidine |
| SMILES | Cc1ccccc1CN1CCCC1CBr |
| InChI | InChI=1S/C13H18BrN/c1-11-5-2-3-6-12(11)10-15-8-4-7-13(15)9-14/h2-3,5-6,13H,4,7-10H2,1H3 |
| InChIKey | UHOMMJIMRGPURR-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.20 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|