C15H22BrN — CID 80677057
2-(bromomethyl)-1-[(2,4,6-trimethylphenyl)methyl]pyrrolidine (PubChem CID 80677057) has the molecular formula C15H22BrN and a molecular weight of 296.25 g/mol. Its IUPAC name is 2-(bromomethyl)-1-[(2,4,6-trimethylphenyl)methyl]pyrrolidine.
| Compound Name | 2-(bromomethyl)-1-[(2,4,6-trimethylphenyl)methyl]pyrrolidine |
|---|---|
| PubChem CID | 80677057 |
| Molecular Formula | C15H22BrN |
| Molecular Weight | 296.25 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 2-(bromomethyl)-1-[(2,4,6-trimethylphenyl)methyl]pyrrolidine |
| SMILES | Cc1cc(C)c(CN2CCCC2CBr)c(C)c1 |
| InChI | InChI=1S/C15H22BrN/c1-11-7-12(2)15(13(3)8-11)10-17-6-4-5-14(17)9-16/h7-8,14H,4-6,9-10H2,1-3H3 |
| InChIKey | AKBWSMMOAZIOFL-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.25 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|