C15H21NO — CID 63846016
1-[1-[(2-methylphenyl)methyl]piperidin-2-yl]ethanone (PubChem CID 63846016) has the molecular formula C15H21NO and a molecular weight of 231.34 g/mol. Its IUPAC name is 1-[1-[(2-methylphenyl)methyl]piperidin-2-yl]ethanone.
| Compound Name | 1-[1-[(2-methylphenyl)methyl]piperidin-2-yl]ethanone |
|---|---|
| PubChem CID | 63846016 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | 1-[1-[(2-methylphenyl)methyl]piperidin-2-yl]ethanone |
| SMILES | CC(=O)C1CCCCN1Cc1ccccc1C |
| InChI | InChI=1S/C15H21NO/c1-12-7-3-4-8-14(12)11-16-10-6-5-9-15(16)13(2)17/h3-4,7-8,15H,5-6,9-11H2,1-2H3 |
| InChIKey | OBDCPLBFTXWNHH-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |