1-[(2,4-dimethylphenyl)methyl]azepane-2-carboxylic acid

C16H23NO2 — CID 65069954

IUPAC1-[(2,4-dimethylphenyl)methyl]azepane-2-carboxylic acid
SMILESCc1ccc(CN2CCCCCC2C(=O)O)c(C)c1
InChIInChI=1S/C16H23NO2/c1-12-7-8-14(13(2)10-12)11-17-9-5-3-4-6-15(17)16(18)19/h7-8,10,15H,3-6,9,11H2,1-2H3,(H,18,19)
InChIKeyGPBHLHLKDKWYLM-UHFFFAOYSA-N
MW261.37 g/mol
LogP3.13
Rot. Bonds3

About 1-[(2,4-dimethylphenyl)methyl]azepane-2-carboxylic acid

1-[(2,4-dimethylphenyl)methyl]azepane-2-carboxylic acid (PubChem CID 65069954) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is 1-[(2,4-dimethylphenyl)methyl]azepane-2-carboxylic acid.

Molecular Properties

Compound Name1-[(2,4-dimethylphenyl)methyl]azepane-2-carboxylic acid
PubChem CID65069954
Molecular FormulaC16H23NO2
Molecular Weight261.37 g/mol
Exact Mass261.17
IUPAC Name1-[(2,4-dimethylphenyl)methyl]azepane-2-carboxylic acid
SMILESCc1ccc(CN2CCCCCC2C(=O)O)c(C)c1
InChIInChI=1S/C16H23NO2/c1-12-7-8-14(13(2)10-12)11-17-9-5-3-4-6-15(17)16(18)19/h7-8,10,15H,3-6,9,11H2,1-2H3,(H,18,19)
InChIKeyGPBHLHLKDKWYLM-UHFFFAOYSA-N
XLogP3.13
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500261.37
LogP ≤ 53.13
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 1-[(2,4-dimethylphenyl)methyl]azepane-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-[(2,4-dimethylphenyl)methyl]azepane-2-carboxylic acid?
The IUPAC name of 1-[(2,4-dimethylphenyl)methyl]azepane-2-carboxylic acid (CID 65069954) is 1-[(2,4-dimethylphenyl)methyl]azepane-2-carboxylic acid.
What is the SMILES notation for 1-[(2,4-dimethylphenyl)methyl]azepane-2-carboxylic acid?
The canonical SMILES for 1-[(2,4-dimethylphenyl)methyl]azepane-2-carboxylic acid is Cc1ccc(CN2CCCCCC2C(=O)O)c(C)c1.
What is the InChIKey of 1-[(2,4-dimethylphenyl)methyl]azepane-2-carboxylic acid?
The InChIKey is GPBHLHLKDKWYLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO2/c1-12-7-8-14(13(2)10-12)11-17-9-5-3-4-6-15(17)16(18)19/h7-8,10,15H,3-6,9,11H2,1-2H3,(H,18,19).
What are the key properties of 1-[(2,4-dimethylphenyl)methyl]azepane-2-carboxylic acid?
1-[(2,4-dimethylphenyl)methyl]azepane-2-carboxylic acid has a molecular weight of 261.37 g/mol, XLogP of 3.13, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2,4-dimethylphenyl)methyl]azepane-2-carboxylic acid is sourced from PubChem (CID 65069954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).