C27H29NP+ — CID 101238580
benzyl-[(2-diphenylphosphanylcyclopenta-2,4-dien-1-yl)methyl]-dimethylazanium (PubChem CID 101238580) has the molecular formula C27H29NP+ and a molecular weight of 398.51 g/mol. Its IUPAC name is benzyl-[(2-diphenylphosphanylcyclopenta-2,4-dien-1-yl)methyl]-dimethylazanium.
| Compound Name | benzyl-[(2-diphenylphosphanylcyclopenta-2,4-dien-1-yl)methyl]-dimethylazanium |
|---|---|
| PubChem CID | 101238580 |
| Molecular Formula | C27H29NP+ |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | benzyl-[(2-diphenylphosphanylcyclopenta-2,4-dien-1-yl)methyl]-dimethylazanium |
| SMILES | C[N+](C)(Cc1ccccc1)CC1C=CC=C1P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H29NP/c1-28(2,21-23-13-6-3-7-14-23)22-24-15-12-20-27(24)29(25-16-8-4-9-17-25)26-18-10-5-11-19-26/h3-20,24H,21-22H2,1-2H3/q+1 |
| InChIKey | UHENSAUSWJIWHC-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|