C31H29NP2 — CID 87789367
(1R)-N-diphenylphosphanyl-1-(2-diphenylphosphanylcyclopenta-2,4-dien-1-yl)ethanamine (PubChem CID 87789367) has the molecular formula C31H29NP2 and a molecular weight of 477.53 g/mol. Its IUPAC name is (1R)-N-diphenylphosphanyl-1-(2-diphenylphosphanylcyclopenta-2,4-dien-1-yl)ethanamine.
| Compound Name | (1R)-N-diphenylphosphanyl-1-(2-diphenylphosphanylcyclopenta-2,4-dien-1-yl)ethanamine |
|---|---|
| PubChem CID | 87789367 |
| Molecular Formula | C31H29NP2 |
| Molecular Weight | 477.53 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | (1R)-N-diphenylphosphanyl-1-(2-diphenylphosphanylcyclopenta-2,4-dien-1-yl)ethanamine |
| SMILES | C[C@@H](NP(c1ccccc1)c1ccccc1)C1C=CC=C1P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H29NP2/c1-25(32-34(28-19-10-4-11-20-28)29-21-12-5-13-22-29)30-23-14-24-31(30)33(26-15-6-2-7-16-26)27-17-8-3-9-18-27/h2-25,30,32H,1H3/t25-,30?/m1/s1 |
| InChIKey | HTEROAGTFATZTL-GOWJNXQMSA-N |
| XLogP | 6.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.53 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|