C17H14FP — CID 176541891
(5-fluorocyclopenta-1,3-dien-1-yl)-diphenylphosphane (PubChem CID 176541891) has the molecular formula C17H14FP and a molecular weight of 268.27 g/mol. Its IUPAC name is (5-fluorocyclopenta-1,3-dien-1-yl)-diphenylphosphane.
| Compound Name | (5-fluorocyclopenta-1,3-dien-1-yl)-diphenylphosphane |
|---|---|
| PubChem CID | 176541891 |
| Molecular Formula | C17H14FP |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | (5-fluorocyclopenta-1,3-dien-1-yl)-diphenylphosphane |
| SMILES | FC1C=CC=C1P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H14FP/c18-16-12-7-13-17(16)19(14-8-3-1-4-9-14)15-10-5-2-6-11-15/h1-13,16H |
| InChIKey | BJPFBJOIPAENOM-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|