C20H21OP — CID 176546157
[5-(ethoxymethyl)cyclopenta-1,3-dien-1-yl]-diphenylphosphane (PubChem CID 176546157) has the molecular formula C20H21OP and a molecular weight of 308.36 g/mol. Its IUPAC name is [5-(ethoxymethyl)cyclopenta-1,3-dien-1-yl]-diphenylphosphane.
| Compound Name | [5-(ethoxymethyl)cyclopenta-1,3-dien-1-yl]-diphenylphosphane |
|---|---|
| PubChem CID | 176546157 |
| Molecular Formula | C20H21OP |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | [5-(ethoxymethyl)cyclopenta-1,3-dien-1-yl]-diphenylphosphane |
| SMILES | CCOCC1C=CC=C1P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H21OP/c1-2-21-16-17-10-9-15-20(17)22(18-11-5-3-6-12-18)19-13-7-4-8-14-19/h3-15,17H,2,16H2,1H3 |
| InChIKey | OSNRDBYKTMNIIT-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|