C28H32F6P2 — CID 87228412
[2-bis[4-(trifluoromethyl)phenyl]phosphanylcyclopenta-2,4-dien-1-yl]methyl-ditert-butylphosphane (PubChem CID 87228412) has the molecular formula C28H32F6P2 and a molecular weight of 544.50 g/mol. Its IUPAC name is [2-bis[4-(trifluoromethyl)phenyl]phosphanylcyclopenta-2,4-dien-1-yl]methyl-ditert-butylphosphane.
| Compound Name | [2-bis[4-(trifluoromethyl)phenyl]phosphanylcyclopenta-2,4-dien-1-yl]methyl-ditert-butylphosphane |
|---|---|
| PubChem CID | 87228412 |
| Molecular Formula | C28H32F6P2 |
| Molecular Weight | 544.50 g/mol |
| Exact Mass | 544.19 |
| IUPAC Name | [2-bis[4-(trifluoromethyl)phenyl]phosphanylcyclopenta-2,4-dien-1-yl]methyl-ditert-butylphosphane |
| SMILES | CC(C)(C)P(CC1C=CC=C1P(c1ccc(C(F)(F)F)cc1)c1ccc(C(F)(F)F)cc1)C(C)(C)C |
| InChI | InChI=1S/C28H32F6P2/c1-25(2,3)35(26(4,5)6)18-19-8-7-9-24(19)36(22-14-10-20(11-15-22)27(29,30)31)23-16-12-21(13-17-23)28(32,33)34/h7-17,19H,18H2,1-6H3 |
| InChIKey | CSVMBADSBXMNAK-UHFFFAOYSA-N |
| XLogP | 9.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.50 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|